C38H43N3O5 — CID 11767314
tert-butyl (4S,5S)-4-benzyl-5-[[(2S)-2-benzyl-3-oxo-4-[(4R)-1-oxo-3,4-dihydro-2H-isoquinolin-4-yl]-1H-pyrrol-2-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11767314) has the molecular formula C38H43N3O5 and a molecular weight of 621.78 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-benzyl-5-[[(2S)-2-benzyl-3-oxo-4-[(4R)-1-oxo-3,4-dihydro-2H-isoquinolin-4-yl]-1H-pyrrol-2-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-benzyl-5-[[(2S)-2-benzyl-3-oxo-4-[(4R)-1-oxo-3,4-dihydro-2H-isoquinolin-4-yl]-1H-pyrrol-2-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11767314 |
| Molecular Formula | C38H43N3O5 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | tert-butyl (4S,5S)-4-benzyl-5-[[(2S)-2-benzyl-3-oxo-4-[(4R)-1-oxo-3,4-dihydro-2H-isoquinolin-4-yl]-1H-pyrrol-2-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](Cc2ccccc2)[C@H](C[C@]2(Cc3ccccc3)NC=C([C@@H]3CNC(=O)c4ccccc43)C2=O)OC1(C)C |
| InChI | InChI=1S/C38H43N3O5/c1-36(2,3)46-35(44)41-31(20-25-14-8-6-9-15-25)32(45-37(41,4)5)22-38(21-26-16-10-7-11-17-26)33(42)30(24-40-38)29-23-39-34(43)28-19-13-12-18-27(28)29/h6-19,24,29,31-32,40H,20-23H2,1-5H3,(H,39,43)/t29-,31+,32+,38+/m1/s1 |
| InChIKey | JZCGVCBEANNEIM-OPLHYENRSA-N |
| XLogP | 5.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |