C28H20F12NOP — CID 11767444
bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane (PubChem CID 11767444) has the molecular formula C28H20F12NOP and a molecular weight of 645.42 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 11767444 |
| Molecular Formula | C28H20F12NOP |
| Molecular Weight | 645.42 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
| SMILES | CC(C)[C@H]1COC(c2ccccc2P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=N1 |
| InChI | InChI=1S/C28H20F12NOP/c1-14(2)22-13-42-24(41-22)21-5-3-4-6-23(21)43(19-9-15(25(29,30)31)7-16(10-19)26(32,33)34)20-11-17(27(35,36)37)8-18(12-20)28(38,39)40/h3-12,14,22H,13H2,1-2H3/t22-/m1/s1 |
| InChIKey | VHJNWRXTQCCFOR-JOCHJYFZSA-N |
| XLogP | 8.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.42 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|