C37H74O7Si2 — CID 11767617
(1R,3R,4S,6R,8R,10S,12R,13S)-12-(3-hydroxypropyl)-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol (PubChem CID 11767617) has the molecular formula C37H74O7Si2 and a molecular weight of 687.16 g/mol. Its IUPAC name is (1R,3R,4S,6R,8R,10S,12R,13S)-12-(3-hydroxypropyl)-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol.
| Compound Name | (1R,3R,4S,6R,8R,10S,12R,13S)-12-(3-hydroxypropyl)-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
|---|---|
| PubChem CID | 11767617 |
| Molecular Formula | C37H74O7Si2 |
| Molecular Weight | 687.16 g/mol |
| Exact Mass | 686.50 |
| IUPAC Name | (1R,3R,4S,6R,8R,10S,12R,13S)-12-(3-hydroxypropyl)-1-methyl-4-tri(propan-2-yl)silyloxy-6-[3-tri(propan-2-yl)silyloxypropyl]-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-13-ol |
| SMILES | CC(C)[Si](OCCC[C@@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2O[C@]3(C)CC[C@H](O)[C@@H](CCCO)O[C@H]3C[C@H]2O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H74O7Si2/c1-24(2)45(25(3)4,26(5)6)40-21-15-16-30-22-34(44-46(27(7)8,28(9)10)29(11)12)36-33(41-30)23-35-37(13,43-36)19-18-31(39)32(42-35)17-14-20-38/h24-36,38-39H,14-23H2,1-13H3/t30-,31+,32-,33-,34+,35+,36-,37-/m1/s1 |
| InChIKey | MOHXMPUOQZCMRK-IWRBPGGTSA-N |
| XLogP | 8.91 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.16 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|