About oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium)
oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) (PubChem CID 11767684) has the molecular formula C32H72Cr2N2O7
and a molecular weight of 700.93 g/mol. Its IUPAC name is oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium).
Molecular Properties
| Compound Name | oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) |
| PubChem CID | 11767684 |
| Molecular Formula | C32H72Cr2N2O7 |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 700.41 |
| IUPAC Name | oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-] |
| InChI | InChI=1S/2C16H36N.2Cr.7O/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;;;;;/h2*5-16H2,1-4H3;;;;;;;;;/q2*+1;;;;;;;;2*-1 |
| InChIKey | MMKQSIQNDMIVIN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium)?
The IUPAC name of oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) (CID 11767684) is oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium).
What is the SMILES notation for oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium)?
The canonical SMILES for oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].
What is the InChIKey of oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium)?
The InChIKey is MMKQSIQNDMIVIN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H36N.2Cr.7O/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;;;;;/h2*5-16H2,1-4H3;;;;;;;;;/q2*+1;;;;;;;;2*-1.
What are the key properties of oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium)?
oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) has a molecular weight of 700.93 g/mol, XLogP of 7.08, 26 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for oxido-(oxido(dioxo)chromio)oxy-dioxochromium;bis(tetrabutylazanium) is sourced from PubChem (CID 11767684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).