About CID 11768417
CID 11768417 (PubChem CID 11768417) has the molecular formula C54H74F6OSi6Sn2
and a molecular weight of 1259.11 g/mol.
Molecular Properties
| Compound Name | CID 11768417 |
| PubChem CID | 11768417 |
| Molecular Formula | C54H74F6OSi6Sn2 |
| Molecular Weight | 1259.11 g/mol |
| Exact Mass | 1260.23 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C[Sn](C[Si](C)(C)c1ccc(F)cc1)C[Si](C)(C)c1ccc(F)cc1)c1ccc(F)cc1.C[Si](C)(C[Sn](C[Si](C)(C)c1ccc(F)cc1)C[Si](C)(C)c1ccc(F)cc1)c1ccc(F)cc1.O |
| InChI | InChI=1S/6C9H12FSi.H2O.2Sn/c6*1-11(2,3)9-6-4-8(10)5-7-9;;;/h6*4-7H,1H2,2-3H3;1H2;; |
| InChIKey | QIWLMUNPAQRWSL-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1259.11 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11768417 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11768417?
The IUPAC name of CID 11768417 (CID 11768417) is not available.
What is the SMILES notation for CID 11768417?
The canonical SMILES for CID 11768417 is C[Si](C)(C[Sn](C[Si](C)(C)c1ccc(F)cc1)C[Si](C)(C)c1ccc(F)cc1)c1ccc(F)cc1.C[Si](C)(C[Sn](C[Si](C)(C)c1ccc(F)cc1)C[Si](C)(C)c1ccc(F)cc1)c1ccc(F)cc1.O.
What is the InChIKey of CID 11768417?
The InChIKey is QIWLMUNPAQRWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/6C9H12FSi.H2O.2Sn/c6*1-11(2,3)9-6-4-8(10)5-7-9;;;/h6*4-7H,1H2,2-3H3;1H2;;.
What are the key properties of CID 11768417?
CID 11768417 has a molecular weight of 1259.11 g/mol, XLogP of 11.90, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11768417 is sourced from PubChem (CID 11768417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).