About 5-cyanopentanamide
5-cyanopentanamide (PubChem CID 11768576) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-cyanopentanamide.
Molecular Properties
| Compound Name | 5-cyanopentanamide |
| PubChem CID | 11768576 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-cyanopentanamide |
| SMILES | N#CCCCCC(N)=O |
| InChI | InChI=1S/C6H10N2O/c7-5-3-1-2-4-6(8)9/h1-4H2,(H2,8,9) |
| InChIKey | XZUDGZXKOFPLBC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyanopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyanopentanamide?
The IUPAC name of 5-cyanopentanamide (CID 11768576) is 5-cyanopentanamide.
What is the SMILES notation for 5-cyanopentanamide?
The canonical SMILES for 5-cyanopentanamide is N#CCCCCC(N)=O.
What is the InChIKey of 5-cyanopentanamide?
The InChIKey is XZUDGZXKOFPLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c7-5-3-1-2-4-6(8)9/h1-4H2,(H2,8,9).
What are the key properties of 5-cyanopentanamide?
5-cyanopentanamide has a molecular weight of 126.16 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyanopentanamide is sourced from PubChem (CID 11768576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).