About (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene
(1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 11768627) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene.
Molecular Properties
| Compound Name | (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene |
| PubChem CID | 11768627 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C1=CC2C(C1)[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C10H14/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,7-10H,3-6H2/t7-,8+,9?,10?/m0/s1 |
| InChIKey | HANKSFAYJLDDKP-AFWXGSBKSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene?
The IUPAC name of (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene (CID 11768627) is (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene.
What is the SMILES notation for (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene?
The canonical SMILES for (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene is C1=CC2C(C1)[C@@H]1CC[C@H]2C1.
What is the InChIKey of (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene?
The InChIKey is HANKSFAYJLDDKP-AFWXGSBKSA-N. The full InChI is InChI=1S/C10H14/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,7-10H,3-6H2/t7-,8+,9?,10?/m0/s1.
What are the key properties of (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene?
(1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene has a molecular weight of 134.22 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,7R)-tricyclo[5.2.1.02,6]dec-3-ene is sourced from PubChem (CID 11768627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).