C7H6ClN — CID 11768650
(6E)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 11768650) has the molecular formula C7H6ClN and a molecular weight of 139.58 g/mol. Its IUPAC name is (6E)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 11768650 |
| Molecular Formula | C7H6ClN |
| Molecular Weight | 139.58 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | (6E)-6-(chloromethylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C\C1=C/Cl |
| InChI | InChI=1S/C7H6ClN/c8-5-6-3-1-2-4-7(6)9/h1-5,9H/b6-5+,9-7+ |
| InChIKey | ZQRZTDUORARTHJ-SBIWHPGTSA-N |
| XLogP | 2.25 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|