C6H10O4 — CID 11768706
(1R,2S,3S,4R)-cyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 11768706) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (1R,2S,3S,4R)-cyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4R)-cyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11768706 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (1R,2S,3S,4R)-cyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)C=C[C@H]1O |
| InChI | InChI=1S/C6H10O4/c7-3-1-2-4(8)6(10)5(3)9/h1-10H/t3-,4-,5+,6+/m1/s1 |
| InChIKey | LRUBQXAKGXQBHA-ZXXMMSQZSA-N |
| XLogP | -2.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|