About 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one
2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one (PubChem CID 11768726) has the molecular formula C5H5F2NO2
and a molecular weight of 149.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one |
| PubChem CID | 11768726 |
| Molecular Formula | C5H5F2NO2 |
| Molecular Weight | 149.10 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one |
| SMILES | CC1=NC(C(F)F)OC1=O |
| InChI | InChI=1S/C5H5F2NO2/c1-2-5(9)10-4(8-2)3(6)7/h3-4H,1H3 |
| InChIKey | CEVWGOYYCZJNBA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.10 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one?
The IUPAC name of 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one (CID 11768726) is 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one.
What is the SMILES notation for 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one?
The canonical SMILES for 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one is CC1=NC(C(F)F)OC1=O.
What is the InChIKey of 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one?
The InChIKey is CEVWGOYYCZJNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F2NO2/c1-2-5(9)10-4(8-2)3(6)7/h3-4H,1H3.
What are the key properties of 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one?
2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one has a molecular weight of 149.10 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-4-methyl-2H-1,3-oxazol-5-one is sourced from PubChem (CID 11768726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).