[(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride

C5H12ClNO2 — CID 11768777

IUPAC[(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride
SMILES[Cl-].[NH3+]C1[C@H](O)CC[C@H]1O
InChIInChI=1S/C5H11NO2.ClH/c6-5-3(7)1-2-4(5)8;/h3-5,7-8H,1-2,6H2;1H/t3-,4-;/m1./s1
InChIKeyRIGOGNYASWZEOE-VKKIDBQXSA-N
MW153.61 g/mol
LogP-4.88
Rot. Bonds

About [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride

[(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride (PubChem CID 11768777) has the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. Its IUPAC name is [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride.

Molecular Properties

Compound Name[(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride
PubChem CID11768777
Molecular FormulaC5H12ClNO2
Molecular Weight153.61 g/mol
Exact Mass153.06
IUPAC Name[(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride
SMILES[Cl-].[NH3+]C1[C@H](O)CC[C@H]1O
InChIInChI=1S/C5H11NO2.ClH/c6-5-3(7)1-2-4(5)8;/h3-5,7-8H,1-2,6H2;1H/t3-,4-;/m1./s1
InChIKeyRIGOGNYASWZEOE-VKKIDBQXSA-N
XLogP-4.88
TPSA68.10 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.61
LogP ≤ 5-4.88
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride?
The IUPAC name of [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride (CID 11768777) is [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride.
What is the SMILES notation for [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride?
The canonical SMILES for [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride is [Cl-].[NH3+]C1[C@H](O)CC[C@H]1O.
What is the InChIKey of [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride?
The InChIKey is RIGOGNYASWZEOE-VKKIDBQXSA-N. The full InChI is InChI=1S/C5H11NO2.ClH/c6-5-3(7)1-2-4(5)8;/h3-5,7-8H,1-2,6H2;1H/t3-,4-;/m1./s1.
What are the key properties of [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride?
[(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride has a molecular weight of 153.61 g/mol, XLogP of -4.88, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5R)-2,5-dihydroxycyclopentyl]azanium chloride is sourced from PubChem (CID 11768777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).