About 2-propylindazole
2-propylindazole (PubChem CID 11768860) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-propylindazole.
Molecular Properties
| Compound Name | 2-propylindazole |
| PubChem CID | 11768860 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-propylindazole |
| SMILES | CCCn1cc2ccccc2n1 |
| InChI | InChI=1S/C10H12N2/c1-2-7-12-8-9-5-3-4-6-10(9)11-12/h3-6,8H,2,7H2,1H3 |
| InChIKey | GJNUYXSRWYPKQO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylindazole?
The IUPAC name of 2-propylindazole (CID 11768860) is 2-propylindazole.
What is the SMILES notation for 2-propylindazole?
The canonical SMILES for 2-propylindazole is CCCn1cc2ccccc2n1.
What is the InChIKey of 2-propylindazole?
The InChIKey is GJNUYXSRWYPKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-7-12-8-9-5-3-4-6-10(9)11-12/h3-6,8H,2,7H2,1H3.
What are the key properties of 2-propylindazole?
2-propylindazole has a molecular weight of 160.22 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylindazole is sourced from PubChem (CID 11768860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).