About hydrogen carbonate;triethylazanium
hydrogen carbonate;triethylazanium (PubChem CID 11768884) has the molecular formula C7H17NO3
and a molecular weight of 163.22 g/mol. Its IUPAC name is hydrogen carbonate;triethylazanium.
Molecular Properties
| Compound Name | hydrogen carbonate;triethylazanium |
| PubChem CID | 11768884 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | hydrogen carbonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C([O-])O |
| InChI | InChI=1S/C6H15N.CH2O3/c1-4-7(5-2)6-3;2-1(3)4/h4-6H2,1-3H3;(H2,2,3,4) |
| InChIKey | AFQIYTIJXGTIEY-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydrogen carbonate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen carbonate;triethylazanium?
The IUPAC name of hydrogen carbonate;triethylazanium (CID 11768884) is hydrogen carbonate;triethylazanium.
What is the SMILES notation for hydrogen carbonate;triethylazanium?
The canonical SMILES for hydrogen carbonate;triethylazanium is CC[NH+](CC)CC.O=C([O-])O.
What is the InChIKey of hydrogen carbonate;triethylazanium?
The InChIKey is AFQIYTIJXGTIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CH2O3/c1-4-7(5-2)6-3;2-1(3)4/h4-6H2,1-3H3;(H2,2,3,4).
What are the key properties of hydrogen carbonate;triethylazanium?
hydrogen carbonate;triethylazanium has a molecular weight of 163.22 g/mol, XLogP of -1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen carbonate;triethylazanium is sourced from PubChem (CID 11768884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).