C6H12O5 — CID 11768891
(2R,3R,4S,5R)-2-methoxyoxane-3,4,5-triol (PubChem CID 11768891) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11768891 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3-9H,2H2,1H3/t3-,4+,5-,6-/m1/s1 |
| InChIKey | ZBDGHWFPLXXWRD-JGWLITMVSA-N |
| XLogP | -1.93 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |