About (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one
(3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one (PubChem CID 11769073) has the molecular formula C7H12O5
and a molecular weight of 176.17 g/mol. Its IUPAC name is (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one.
Molecular Properties
| Compound Name | (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one |
| PubChem CID | 11769073 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one |
| SMILES | O=C1O[C@H](C[C@H](O)CO)C[C@@H]1O |
| InChI | InChI=1S/C7H12O5/c8-3-4(9)1-5-2-6(10)7(11)12-5/h4-6,8-10H,1-3H2/t4-,5+,6-/m0/s1 |
| InChIKey | MDFWLPMSLAYNBD-JKUQZMGJSA-N |
| XLogP | -1.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one?
The IUPAC name of (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one (CID 11769073) is (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one.
What is the SMILES notation for (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one?
The canonical SMILES for (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one is O=C1O[C@H](C[C@H](O)CO)C[C@@H]1O.
What is the InChIKey of (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one?
The InChIKey is MDFWLPMSLAYNBD-JKUQZMGJSA-N. The full InChI is InChI=1S/C7H12O5/c8-3-4(9)1-5-2-6(10)7(11)12-5/h4-6,8-10H,1-3H2/t4-,5+,6-/m0/s1.
What are the key properties of (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one?
(3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one has a molecular weight of 176.17 g/mol, XLogP of -1.59, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-5-[(2S)-2,3-dihydroxypropyl]-3-hydroxyoxolan-2-one is sourced from PubChem (CID 11769073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).