About (1S)-1-phenylhexan-1-ol
(1S)-1-phenylhexan-1-ol (PubChem CID 11769111) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is (1S)-1-phenylhexan-1-ol.
Molecular Properties
| Compound Name | (1S)-1-phenylhexan-1-ol |
| PubChem CID | 11769111 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1S)-1-phenylhexan-1-ol |
| SMILES | CCCCC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H18O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12-13H,2-3,5,10H2,1H3/t12-/m0/s1 |
| InChIKey | SVCRDVHXRDRHCP-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-phenylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-phenylhexan-1-ol?
The IUPAC name of (1S)-1-phenylhexan-1-ol (CID 11769111) is (1S)-1-phenylhexan-1-ol.
What is the SMILES notation for (1S)-1-phenylhexan-1-ol?
The canonical SMILES for (1S)-1-phenylhexan-1-ol is CCCCC[C@H](O)c1ccccc1.
What is the InChIKey of (1S)-1-phenylhexan-1-ol?
The InChIKey is SVCRDVHXRDRHCP-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H18O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12-13H,2-3,5,10H2,1H3/t12-/m0/s1.
What are the key properties of (1S)-1-phenylhexan-1-ol?
(1S)-1-phenylhexan-1-ol has a molecular weight of 178.28 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-phenylhexan-1-ol is sourced from PubChem (CID 11769111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).