C6H8N6O2 — CID 11769412
(1R,2R,3S,6S)-3,6-diazidocyclohex-4-ene-1,2-diol (PubChem CID 11769412) has the molecular formula C6H8N6O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is (1R,2R,3S,6S)-3,6-diazidocyclohex-4-ene-1,2-diol.
| Compound Name | (1R,2R,3S,6S)-3,6-diazidocyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 11769412 |
| Molecular Formula | C6H8N6O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1R,2R,3S,6S)-3,6-diazidocyclohex-4-ene-1,2-diol |
| SMILES | [N-]=[N+]=N[C@H]1C=C[C@H](N=[N+]=[N-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H8N6O2/c7-11-9-3-1-2-4(10-12-8)6(14)5(3)13/h1-6,13-14H/t3-,4-,5+,6+/m0/s1 |
| InChIKey | VYVHFQKYMBMIKC-UNTFVMJOSA-N |
| XLogP | 0.64 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|