About 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one
1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 11769513) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one |
| PubChem CID | 11769513 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | O=C1C=C(CCCCl)C2CCCN12 |
| InChI | InChI=1S/C10H14ClNO/c11-5-1-3-8-7-10(13)12-6-2-4-9(8)12/h7,9H,1-6H2 |
| InChIKey | LHEVVVQOKBXEJK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one?
The IUPAC name of 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one (CID 11769513) is 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one.
What is the SMILES notation for 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one?
The canonical SMILES for 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one is O=C1C=C(CCCCl)C2CCCN12.
What is the InChIKey of 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one?
The InChIKey is LHEVVVQOKBXEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO/c11-5-1-3-8-7-10(13)12-6-2-4-9(8)12/h7,9H,1-6H2.
What are the key properties of 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one?
1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one has a molecular weight of 199.68 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-5,6,7,8-tetrahydropyrrolizin-3-one is sourced from PubChem (CID 11769513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).