C13H16O2 — CID 11769616
(3Z,8S,11S)-9-oxatricyclo[6.5.1.011,14]tetradeca-1(14),3-dien-13-one (PubChem CID 11769616) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (3Z,8S,11S)-9-oxatricyclo[6.5.1.011,14]tetradeca-1(14),3-dien-13-one.
| Compound Name | (3Z,8S,11S)-9-oxatricyclo[6.5.1.011,14]tetradeca-1(14),3-dien-13-one |
|---|---|
| PubChem CID | 11769616 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3Z,8S,11S)-9-oxatricyclo[6.5.1.011,14]tetradeca-1(14),3-dien-13-one |
| SMILES | O=C1C[C@@H]2CO[C@H]3CCC/C=C\CC1=C23 |
| InChI | InChI=1S/C13H16O2/c14-11-7-9-8-15-12-6-4-2-1-3-5-10(11)13(9)12/h1,3,9,12H,2,4-8H2/b3-1-/t9-,12+/m1/s1 |
| InChIKey | SWOAHDWZBQVFSX-UYROATGTSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|