C26H22F3N7O — CID 117698495
(9S)-N-[6-(2-methylpyrazol-3-yl)pyridin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 117698495) has the molecular formula C26H22F3N7O and a molecular weight of 505.50 g/mol. Its IUPAC name is (9S)-N-[6-(2-methylpyrazol-3-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[6-(2-methylpyrazol-3-yl)pyridin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 117698495 |
| Molecular Formula | C26H22F3N7O |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (9S)-N-[6-(2-methylpyrazol-3-yl)-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CN1C(=CC=N1)C2=NC(=CC=C2)NC(=O)N3[C@H]4CCN(C4)C5=C3N=C(C=C5)C6=CC(=CC=C6)C(F)(F)F |
| InChI | InChI=1S/C26H22F3N7O/c1-34-21(10-12-30-34)20-6-3-7-23(31-20)33-25(37)36-18-11-13-35(15-18)22-9-8-19(32-24(22)36)16-4-2-5-17(14-16)26(27,28)29/h2-10,12,14,18H,11,13,15H2,1H3,(H,31,33,37)/t18-/m0/s1 |
| InChIKey | BOXYWTNKIGQECL-SFHVURJKSA-N |
| XLogP | 3.80 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | 830 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |