C15H22O — CID 11769943
3-[2-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]furan (PubChem CID 11769943) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-[2-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]furan.
| Compound Name | 3-[2-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]furan |
|---|---|
| PubChem CID | 11769943 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 3-[2-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]furan |
| SMILES | CC1=CCC[C@@H](C)[C@@]1(C)CCc1ccoc1 |
| InChI | InChI=1S/C15H22O/c1-12-5-4-6-13(2)15(12,3)9-7-14-8-10-16-11-14/h5,8,10-11,13H,4,6-7,9H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | AIKFIBDPVFKLSI-HIFRSBDPSA-N |
| XLogP | 4.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|