About 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile
2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile (PubChem CID 11770035) has the molecular formula C12H6N4O
and a molecular weight of 222.21 g/mol. Its IUPAC name is 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile |
| PubChem CID | 11770035 |
| Molecular Formula | C12H6N4O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)n2c1oc1ccccc12 |
| InChI | InChI=1S/C12H6N4O/c13-5-7-11(15)9(6-14)16-8-3-1-2-4-10(8)17-12(7)16/h1-4H,15H2 |
| InChIKey | YJRMNLXEUICTOG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile?
The IUPAC name of 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile (CID 11770035) is 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile.
What is the SMILES notation for 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile?
The canonical SMILES for 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile is N#Cc1c(N)c(C#N)n2c1oc1ccccc12.
What is the InChIKey of 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile?
The InChIKey is YJRMNLXEUICTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N4O/c13-5-7-11(15)9(6-14)16-8-3-1-2-4-10(8)17-12(7)16/h1-4H,15H2.
What are the key properties of 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile?
2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile has a molecular weight of 222.21 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyrrolo[2,1-b][1,3]benzoxazole-1,3-dicarbonitrile is sourced from PubChem (CID 11770035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).