C8H10F3NO3 — CID 11770121
(2S,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid (PubChem CID 11770121) has the molecular formula C8H10F3NO3 and a molecular weight of 225.17 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid.
| Compound Name | (2S,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 11770121 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (2S,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid |
| SMILES | C=C[C@@H](C)[C@H](NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H10F3NO3/c1-3-4(2)5(6(13)14)12-7(15)8(9,10)11/h3-5H,1H2,2H3,(H,12,15)(H,13,14)/t4-,5+/m1/s1 |
| InChIKey | SJWVXFYBDFJOFF-UHNVWZDZSA-N |
| XLogP | 0.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|