C14H18N2O — CID 11770275
1,2,9-trimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-6-ol (PubChem CID 11770275) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1,2,9-trimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-6-ol.
| Compound Name | 1,2,9-trimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 11770275 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1,2,9-trimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-6-ol |
| SMILES | CC1c2c(c3cc(O)ccc3n2C)CCN1C |
| InChI | InChI=1S/C14H18N2O/c1-9-14-11(6-7-15(9)2)12-8-10(17)4-5-13(12)16(14)3/h4-5,8-9,17H,6-7H2,1-3H3 |
| InChIKey | BRMRCOJZNYPVQA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|