About trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane
trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane (PubChem CID 11770279) has the molecular formula C10H22O2Si2
and a molecular weight of 230.46 g/mol. Its IUPAC name is trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane |
| PubChem CID | 11770279 |
| Molecular Formula | C10H22O2Si2 |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane |
| SMILES | C=C(/C=C/O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H22O2Si2/c1-10(12-14(5,6)7)8-9-11-13(2,3)4/h8-9H,1H2,2-7H3/b9-8+ |
| InChIKey | XYAVQBLCFRUPDA-CMDGGOBGSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane?
The IUPAC name of trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane (CID 11770279) is trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane.
What is the SMILES notation for trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane?
The canonical SMILES for trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane is C=C(/C=C/O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane?
The InChIKey is XYAVQBLCFRUPDA-CMDGGOBGSA-N. The full InChI is InChI=1S/C10H22O2Si2/c1-10(12-14(5,6)7)8-9-11-13(2,3)4/h8-9H,1H2,2-7H3/b9-8+.
What are the key properties of trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane?
trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane has a molecular weight of 230.46 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1E)-3-trimethylsilyloxybuta-1,3-dienoxy]silane is sourced from PubChem (CID 11770279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).