About 1-(3-methylhepta-1,2-dienyl)naphthalene
1-(3-methylhepta-1,2-dienyl)naphthalene (PubChem CID 11770476) has the molecular formula C18H20
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(3-methylhepta-1,2-dienyl)naphthalene.
Molecular Properties
| Compound Name | 1-(3-methylhepta-1,2-dienyl)naphthalene |
| PubChem CID | 11770476 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(3-methylhepta-1,2-dienyl)naphthalene |
| SMILES | CCCCC(C)=C=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H20/c1-3-4-8-15(2)13-14-17-11-7-10-16-9-5-6-12-18(16)17/h5-7,9-12,14H,3-4,8H2,1-2H3 |
| InChIKey | MXOASWGSHDRGIU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3-methylhepta-1,2-dienyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylhepta-1,2-dienyl)naphthalene?
The IUPAC name of 1-(3-methylhepta-1,2-dienyl)naphthalene (CID 11770476) is 1-(3-methylhepta-1,2-dienyl)naphthalene.
What is the SMILES notation for 1-(3-methylhepta-1,2-dienyl)naphthalene?
The canonical SMILES for 1-(3-methylhepta-1,2-dienyl)naphthalene is CCCCC(C)=C=Cc1cccc2ccccc12.
What is the InChIKey of 1-(3-methylhepta-1,2-dienyl)naphthalene?
The InChIKey is MXOASWGSHDRGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20/c1-3-4-8-15(2)13-14-17-11-7-10-16-9-5-6-12-18(16)17/h5-7,9-12,14H,3-4,8H2,1-2H3.
What are the key properties of 1-(3-methylhepta-1,2-dienyl)naphthalene?
1-(3-methylhepta-1,2-dienyl)naphthalene has a molecular weight of 236.36 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylhepta-1,2-dienyl)naphthalene is sourced from PubChem (CID 11770476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).