About N-tridecan-6-ylacetamide
N-tridecan-6-ylacetamide (PubChem CID 11770595) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is N-tridecan-6-ylacetamide.
Molecular Properties
| Compound Name | N-tridecan-6-ylacetamide |
| PubChem CID | 11770595 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N-tridecan-6-ylacetamide |
| SMILES | CCCCCCCC(CCCCC)NC(C)=O |
| InChI | InChI=1S/C15H31NO/c1-4-6-8-9-11-13-15(16-14(3)17)12-10-7-5-2/h15H,4-13H2,1-3H3,(H,16,17) |
| InChIKey | RMTOFKWPCZJSGD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tridecan-6-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tridecan-6-ylacetamide?
The IUPAC name of N-tridecan-6-ylacetamide (CID 11770595) is N-tridecan-6-ylacetamide.
What is the SMILES notation for N-tridecan-6-ylacetamide?
The canonical SMILES for N-tridecan-6-ylacetamide is CCCCCCCC(CCCCC)NC(C)=O.
What is the InChIKey of N-tridecan-6-ylacetamide?
The InChIKey is RMTOFKWPCZJSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-4-6-8-9-11-13-15(16-14(3)17)12-10-7-5-2/h15H,4-13H2,1-3H3,(H,16,17).
What are the key properties of N-tridecan-6-ylacetamide?
N-tridecan-6-ylacetamide has a molecular weight of 241.42 g/mol, XLogP of 4.43, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tridecan-6-ylacetamide is sourced from PubChem (CID 11770595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).