C18H21BO3 — CID 11770905
1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone (PubChem CID 11770905) has the molecular formula C18H21BO3 and a molecular weight of 296.18 g/mol. Its IUPAC name is 1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone.
| Compound Name | 1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 11770905 |
| Molecular Formula | C18H21BO3 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc2ccccc2c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H21BO3/c1-12(20)14-11-10-13-8-6-7-9-15(13)16(14)19-21-17(2,3)18(4,5)22-19/h6-11H,1-5H3 |
| InChIKey | VAUPRXKWSDMTMF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|