C19H23NO2 — CID 11770956
2-(2,2-diphenyl-1,3-dioxolan-4-yl)-N,N-dimethylethanamine (PubChem CID 11770956) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(2,2-diphenyl-1,3-dioxolan-4-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(2,2-diphenyl-1,3-dioxolan-4-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 11770956 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(2,2-diphenyl-1,3-dioxolan-4-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C19H23NO2/c1-20(2)14-13-18-15-21-19(22-18,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3 |
| InChIKey | KLBVUIXFCUSLJI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |