C20H32S — CID 11771158
3-[(4Z,6E)-5,6-dipropyldeca-4,6-dien-4-yl]thiophene (PubChem CID 11771158) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is 3-[(4Z,6E)-5,6-dipropyldeca-4,6-dien-4-yl]thiophene.
| Compound Name | 3-[(4Z,6E)-5,6-dipropyldeca-4,6-dien-4-yl]thiophene |
|---|---|
| PubChem CID | 11771158 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 3-[(4Z,6E)-5,6-dipropyldeca-4,6-dien-4-yl]thiophene |
| SMILES | CCC/C=C(CCC)/C(CCC)=C(/CCC)c1ccsc1 |
| InChI | InChI=1S/C20H32S/c1-5-9-13-17(10-6-2)19(11-7-3)20(12-8-4)18-14-15-21-16-18/h13-16H,5-12H2,1-4H3/b17-13+,20-19- |
| InChIKey | NBOCREXFTBSSBU-YWKYIXQJSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|