About methyl(tripropyl)azanium;trifluoromethanesulfonate
methyl(tripropyl)azanium;trifluoromethanesulfonate (PubChem CID 11771226) has the molecular formula C11H24F3NO3S
and a molecular weight of 307.38 g/mol. Its IUPAC name is methyl(tripropyl)azanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | methyl(tripropyl)azanium;trifluoromethanesulfonate |
| PubChem CID | 11771226 |
| Molecular Formula | C11H24F3NO3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl(tripropyl)azanium;trifluoromethanesulfonate |
| SMILES | CCC[N+](C)(CCC)CCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H24N.CHF3O3S/c1-5-8-11(4,9-6-2)10-7-3;2-1(3,4)8(5,6)7/h5-10H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AFDNEAAQDGUENW-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl(tripropyl)azanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(tripropyl)azanium;trifluoromethanesulfonate?
The IUPAC name of methyl(tripropyl)azanium;trifluoromethanesulfonate (CID 11771226) is methyl(tripropyl)azanium;trifluoromethanesulfonate.
What is the SMILES notation for methyl(tripropyl)azanium;trifluoromethanesulfonate?
The canonical SMILES for methyl(tripropyl)azanium;trifluoromethanesulfonate is CCC[N+](C)(CCC)CCC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of methyl(tripropyl)azanium;trifluoromethanesulfonate?
The InChIKey is AFDNEAAQDGUENW-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H24N.CHF3O3S/c1-5-8-11(4,9-6-2)10-7-3;2-1(3,4)8(5,6)7/h5-10H2,1-4H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of methyl(tripropyl)azanium;trifluoromethanesulfonate?
methyl(tripropyl)azanium;trifluoromethanesulfonate has a molecular weight of 307.38 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(tripropyl)azanium;trifluoromethanesulfonate is sourced from PubChem (CID 11771226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).