C12H11Cl2N3O2S — CID 11771905
N-[(3,6-dichloropyridazin-4-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 11771905) has the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.21 g/mol. Its IUPAC name is N-[(3,6-dichloropyridazin-4-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3,6-dichloropyridazin-4-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11771905 |
| Molecular Formula | C12H11Cl2N3O2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[(3,6-dichloropyridazin-4-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cc(Cl)nnc2Cl)cc1 |
| InChI | InChI=1S/C12H11Cl2N3O2S/c1-8-2-4-10(5-3-8)20(18,19)15-7-9-6-11(13)16-17-12(9)14/h2-6,15H,7H2,1H3 |
| InChIKey | RUEFJZNBXJANFH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |