C15H9Cl2N3S — CID 11771968
4-(3,4-dichlorophenyl)sulfanyl-2-pyridin-2-ylpyrimidine (PubChem CID 11771968) has the molecular formula C15H9Cl2N3S and a molecular weight of 334.23 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)sulfanyl-2-pyridin-2-ylpyrimidine.
| Compound Name | 4-(3,4-dichlorophenyl)sulfanyl-2-pyridin-2-ylpyrimidine |
|---|---|
| PubChem CID | 11771968 |
| Molecular Formula | C15H9Cl2N3S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 4-(3,4-dichlorophenyl)sulfanyl-2-pyridin-2-ylpyrimidine |
| SMILES | Clc1ccc(Sc2ccnc(-c3ccccn3)n2)cc1Cl |
| InChI | InChI=1S/C15H9Cl2N3S/c16-11-5-4-10(9-12(11)17)21-14-6-8-19-15(20-14)13-3-1-2-7-18-13/h1-9H |
| InChIKey | OHXDZMRKYJSXLE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |