C7H5N3O7 — CID 11772
3-methyl-2,4,6-trinitrophenol (PubChem CID 11772) has the molecular formula C7H5N3O7 and a molecular weight of 243.13 g/mol. Its IUPAC name is 3-methyl-2,4,6-trinitrophenol.
| Compound Name | 3-methyl-2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 11772 |
| Molecular Formula | C7H5N3O7 |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 3-methyl-2,4,6-trinitrophenol |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N3O7/c1-3-4(8(12)13)2-5(9(14)15)7(11)6(3)10(16)17/h2,11H,1H3 |
| InChIKey | YYGJRRYSYLLCQH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|