C18H24N4OS — CID 11772312
2-[(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)methylsulfanyl]-1H-benzimidazole-4-carboxamide (PubChem CID 11772312) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)methylsulfanyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)methylsulfanyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11772312 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)methylsulfanyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CC1(C)C=C(CSc2nc3c(C(N)=O)cccc3[nH]2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H24N4OS/c1-17(2)8-11(9-18(3,4)22-17)10-24-16-20-13-7-5-6-12(15(19)23)14(13)21-16/h5-8,22H,9-10H2,1-4H3,(H2,19,23)(H,20,21) |
| InChIKey | NDYRRDODJUJDMX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|