About tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate
tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate (PubChem CID 11772325) has the molecular formula C17H25ClO3S
and a molecular weight of 344.90 g/mol. Its IUPAC name is tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate.
Molecular Properties
| Compound Name | tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate |
| PubChem CID | 11772325 |
| Molecular Formula | C17H25ClO3S |
| Molecular Weight | 344.90 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate |
| SMILES | Cc1ccc(S(=O)C(Cl)C(C)(C)CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25ClO3S/c1-12-7-9-13(10-8-12)22(20)15(18)17(5,6)11-14(19)21-16(2,3)4/h7-10,15H,11H2,1-6H3 |
| InChIKey | TZVRWTJRNROXAZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate?
The IUPAC name of tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate (CID 11772325) is tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate.
What is the SMILES notation for tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate?
The canonical SMILES for tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate is Cc1ccc(S(=O)C(Cl)C(C)(C)CC(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate?
The InChIKey is TZVRWTJRNROXAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClO3S/c1-12-7-9-13(10-8-12)22(20)15(18)17(5,6)11-14(19)21-16(2,3)4/h7-10,15H,11H2,1-6H3.
What are the key properties of tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate?
tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate has a molecular weight of 344.90 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-chloro-3,3-dimethyl-4-(4-methylphenyl)sulfinylbutanoate is sourced from PubChem (CID 11772325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).