About [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate
[(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate (PubChem CID 11772414) has the molecular formula C18H17FO4S
and a molecular weight of 348.40 g/mol. Its IUPAC name is [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate |
| PubChem CID | 11772414 |
| Molecular Formula | C18H17FO4S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate |
| SMILES | CC12CC[C@@H](OS(=O)(=O)c3ccc(F)cc3)[C@@]1(c1ccccc1)O2 |
| InChI | InChI=1S/C18H17FO4S/c1-17-12-11-16(18(17,23-17)13-5-3-2-4-6-13)22-24(20,21)15-9-7-14(19)8-10-15/h2-10,16H,11-12H2,1H3/t16-,17?,18-/m1/s1 |
| InChIKey | FJPNNGWDEFRLNA-GVYDCBATSA-N |
| XLogP | 3.38 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate?
The IUPAC name of [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate (CID 11772414) is [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate.
What is the SMILES notation for [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate?
The canonical SMILES for [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate is CC12CC[C@@H](OS(=O)(=O)c3ccc(F)cc3)[C@@]1(c1ccccc1)O2.
What is the InChIKey of [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate?
The InChIKey is FJPNNGWDEFRLNA-GVYDCBATSA-N. The full InChI is InChI=1S/C18H17FO4S/c1-17-12-11-16(18(17,23-17)13-5-3-2-4-6-13)22-24(20,21)15-9-7-14(19)8-10-15/h2-10,16H,11-12H2,1H3/t16-,17?,18-/m1/s1.
What are the key properties of [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate?
[(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate has a molecular weight of 348.40 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-5-methyl-1-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-fluorobenzenesulfonate is sourced from PubChem (CID 11772414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).