C19H24O4S — CID 11772428
(8R,9S,13S,14S)-3-hydroxy-13-methyl-2-methylsulfonyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 11772428) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-methylsulfonyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-methylsulfonyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11772428 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-methylsulfonyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(S(C)(=O)=O)c(O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H24O4S/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(10-14(11)12)24(2,22)23/h9-10,12-13,15,20H,3-8H2,1-2H3/t12-,13+,15-,19-/m0/s1 |
| InChIKey | XNXSFHYWCMGLJS-QPWUGHHJSA-N |
| XLogP | 3.22 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |