C18H22O7 — CID 11772477
(4R,7E,10S,13E,16S)-10,16-dimethyl-4-prop-2-enyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12-tetrone (PubChem CID 11772477) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is (4R,7E,10S,13E,16S)-10,16-dimethyl-4-prop-2-enyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12-tetrone.
| Compound Name | (4R,7E,10S,13E,16S)-10,16-dimethyl-4-prop-2-enyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12-tetrone |
|---|---|
| PubChem CID | 11772477 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (4R,7E,10S,13E,16S)-10,16-dimethyl-4-prop-2-enyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12-tetrone |
| SMILES | C=CC[C@@H]1CC(=O)O[C@@H](C)C/C=C/C(=O)O[C@@H](C)C(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C18H22O7/c1-4-6-14-11-18(22)23-12(2)7-5-8-16(20)24-13(3)15(19)9-10-17(21)25-14/h4-5,8-10,12-14H,1,6-7,11H2,2-3H3/b8-5+,10-9+/t12-,13-,14+/m0/s1 |
| InChIKey | JHULMOIAXFIZFG-ICVBLNQLSA-N |
| XLogP | 1.81 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|