About CID 11772961
CID 11772961 (PubChem CID 11772961) has the molecular formula C20H22FeO3+2
and a molecular weight of 366.24 g/mol.
Molecular Properties
| Compound Name | CID 11772961 |
| PubChem CID | 11772961 |
| Molecular Formula | C20H22FeO3+2 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | — |
| SMILES | C=C(C)C1(O)C(=O)C([C]2[CH][CH][CH][CH]2)=C1OC(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C15H17O3.C5H5.Fe/c1-9(2)15(17)13(16)12(11-7-5-6-8-11)14(15)18-10(3)4;1-2-4-5-3-1;/h5-8,10,17H,1H2,2-4H3;1-5H;/q;;+2 |
| InChIKey | XADXIBBMXCLCTB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 11772961 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11772961?
The IUPAC name of CID 11772961 (CID 11772961) is not available.
What is the SMILES notation for CID 11772961?
The canonical SMILES for CID 11772961 is C=C(C)C1(O)C(=O)C([C]2[CH][CH][CH][CH]2)=C1OC(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11772961?
The InChIKey is XADXIBBMXCLCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17O3.C5H5.Fe/c1-9(2)15(17)13(16)12(11-7-5-6-8-11)14(15)18-10(3)4;1-2-4-5-3-1;/h5-8,10,17H,1H2,2-4H3;1-5H;/q;;+2.
What are the key properties of CID 11772961?
CID 11772961 has a molecular weight of 366.24 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11772961 is sourced from PubChem (CID 11772961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).