C15H19ClN2O — CID 11773059
1-(3-chlorophenyl)-2-[2-(1-methylpyrrol-2-yl)ethylamino]ethanol (PubChem CID 11773059) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[2-(1-methylpyrrol-2-yl)ethylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[2-(1-methylpyrrol-2-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 11773059 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[2-(1-methylpyrrol-2-yl)ethylamino]ethanol |
| SMILES | Cn1cccc1CCNCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O/c1-18-9-3-6-14(18)7-8-17-11-15(19)12-4-2-5-13(16)10-12/h2-6,9-10,15,17,19H,7-8,11H2,1H3 |
| InChIKey | PSHNISUXHGVKQT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|