C24H34O3 — CID 11773109
cis-(2R,3R)-2-[(1E,8E)-deca-1,8-dienyl]-3-[(4-methoxyphenyl)methoxymethyl]cyclopentan-1-one (PubChem CID 11773109) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is cis-(2R,3R)-2-[(1E,8E)-deca-1,8-dienyl]-3-[(4-methoxyphenyl)methoxymethyl]cyclopentan-1-one.
| Compound Name | cis-(2R,3R)-2-[(1E,8E)-deca-1,8-dienyl]-3-[(4-methoxyphenyl)methoxymethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 11773109 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | cis-(2R,3R)-2-[(1E,8E)-deca-1,8-dienyl]-3-[(4-methoxyphenyl)methoxymethyl]cyclopentan-1-one |
| SMILES | C/C=C/CCCCC/C=C/[C@H]1C(=O)CC[C@H]1COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H34O3/c1-3-4-5-6-7-8-9-10-11-23-21(14-17-24(23)25)19-27-18-20-12-15-22(26-2)16-13-20/h3-4,10-13,15-16,21,23H,5-9,14,17-19H2,1-2H3/b4-3+,11-10+/t21-,23+/m0/s1 |
| InChIKey | WRTZMVJCISDAPJ-VJBQHCMDSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|