C22H29NO4 — CID 11773134
methyl (2'S,4'aS,5'S,8'aR)-2'-methyl-5'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,7,8,8a-octahydroquinoline]-1'-carboxylate (PubChem CID 11773134) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is methyl (2'S,4'aS,5'S,8'aR)-2'-methyl-5'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,7,8,8a-octahydroquinoline]-1'-carboxylate.
| Compound Name | methyl (2'S,4'aS,5'S,8'aR)-2'-methyl-5'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,7,8,8a-octahydroquinoline]-1'-carboxylate |
|---|---|
| PubChem CID | 11773134 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | methyl (2'S,4'aS,5'S,8'aR)-2'-methyl-5'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,7,8,8a-octahydroquinoline]-1'-carboxylate |
| SMILES | COC(=O)N1[C@@H]2CCC[C@@H](/C=C/c3ccccc3)[C@@H]2CC2(OCCO2)[C@@H]1C |
| InChI | InChI=1S/C22H29NO4/c1-16-22(26-13-14-27-22)15-19-18(12-11-17-7-4-3-5-8-17)9-6-10-20(19)23(16)21(24)25-2/h3-5,7-8,11-12,16,18-20H,6,9-10,13-15H2,1-2H3/b12-11+/t16-,18-,19-,20+/m0/s1 |
| InChIKey | LKTJMELCKJUQQT-HOMFWSDMSA-N |
| XLogP | 4.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |