About N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide
N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide (PubChem CID 11773437) has the molecular formula C13H11F4N3O4S
and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide |
| PubChem CID | 11773437 |
| Molecular Formula | C13H11F4N3O4S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nccc(-c2cc(OC(F)F)ccc2OC(F)F)n1 |
| InChI | InChI=1S/C13H11F4N3O4S/c1-25(21,22)20-13-18-5-4-9(19-13)8-6-7(23-11(14)15)2-3-10(8)24-12(16)17/h2-6,11-12H,1H3,(H,18,19,20) |
| InChIKey | AIVBKIUEIOLKOR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide?
The IUPAC name of N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide (CID 11773437) is N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide.
What is the SMILES notation for N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide?
The canonical SMILES for N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide is CS(=O)(=O)Nc1nccc(-c2cc(OC(F)F)ccc2OC(F)F)n1.
What is the InChIKey of N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide?
The InChIKey is AIVBKIUEIOLKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F4N3O4S/c1-25(21,22)20-13-18-5-4-9(19-13)8-6-7(23-11(14)15)2-3-10(8)24-12(16)17/h2-6,11-12H,1H3,(H,18,19,20).
What are the key properties of N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide?
N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide has a molecular weight of 381.31 g/mol, XLogP of 2.72, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2,5-bis(difluoromethoxy)phenyl]pyrimidin-2-yl]methanesulfonamide is sourced from PubChem (CID 11773437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).