About 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one
8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 11773441) has the molecular formula C19H12FN3O3S
and a molecular weight of 381.39 g/mol. Its IUPAC name is 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| PubChem CID | 11773441 |
| Molecular Formula | C19H12FN3O3S |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2c(c3ccccc13)Cc1cc(S(=O)(=O)n3ccnc3)c(F)cc1-2 |
| InChI | InChI=1S/C19H12FN3O3S/c20-16-9-14-11(8-17(16)27(25,26)23-6-5-21-10-23)7-15-12-3-1-2-4-13(12)19(24)22-18(14)15/h1-6,8-10H,7H2,(H,22,24) |
| InChIKey | LLBWIKDWKSJTFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
The IUPAC name of 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (CID 11773441) is 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
What is the SMILES notation for 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
The canonical SMILES for 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one is O=c1[nH]c2c(c3ccccc13)Cc1cc(S(=O)(=O)n3ccnc3)c(F)cc1-2.
What is the InChIKey of 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
The InChIKey is LLBWIKDWKSJTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FN3O3S/c20-16-9-14-11(8-17(16)27(25,26)23-6-5-21-10-23)7-15-12-3-1-2-4-13(12)19(24)22-18(14)15/h1-6,8-10H,7H2,(H,22,24).
What are the key properties of 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one has a molecular weight of 381.39 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-9-imidazol-1-ylsulfonyl-6,11-dihydroindeno[1,2-c]isoquinolin-5-one is sourced from PubChem (CID 11773441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).