C20H26N6O2 — CID 11773483
2,5-dimethyl-3-(3-methyl-5-nitro-2-pyridinyl)-N,N-dipropylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11773483) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2,5-dimethyl-3-(3-methyl-5-nitro-2-pyridinyl)-N,N-dipropylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 2,5-dimethyl-3-(3-methyl-5-nitro-2-pyridinyl)-N,N-dipropylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11773483 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2,5-dimethyl-3-(3-methyl-5-nitro-2-pyridinyl)-N,N-dipropylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCN(CCC)c1cc(C)nc2c(-c3ncc([N+](=O)[O-])cc3C)c(C)nn12 |
| InChI | InChI=1S/C20H26N6O2/c1-6-8-24(9-7-2)17-11-14(4)22-20-18(15(5)23-25(17)20)19-13(3)10-16(12-21-19)26(27)28/h10-12H,6-9H2,1-5H3 |
| InChIKey | GYFFFGHMKGSACD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|