C11H16F6N3OPS — CID 11773506
1,3-dimethyl-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-5,6-dihydro-4H-pyrimidin-1-ium hexafluorophosphate (PubChem CID 11773506) has the molecular formula C11H16F6N3OPS and a molecular weight of 383.30 g/mol. Its IUPAC name is 1,3-dimethyl-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-5,6-dihydro-4H-pyrimidin-1-ium hexafluorophosphate.
| Compound Name | 1,3-dimethyl-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-5,6-dihydro-4H-pyrimidin-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 11773506 |
| Molecular Formula | C11H16F6N3OPS |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 1,3-dimethyl-2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-5,6-dihydro-4H-pyrimidin-1-ium hexafluorophosphate |
| SMILES | CN1CCC[N+](C)=C1Sc1cccc[n+]1[O-].F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C11H16N3OS.F6P/c1-12-7-5-8-13(2)11(12)16-10-6-3-4-9-14(10)15;1-7(2,3,4,5)6/h3-4,6,9H,5,7-8H2,1-2H3;/q+1;-1 |
| InChIKey | GKSIQKDHGGAQRL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|