C18H30O5SSi — CID 11773595
(2R,3S,4S,5S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol (PubChem CID 11773595) has the molecular formula C18H30O5SSi and a molecular weight of 386.59 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 11773595 |
| Molecular Formula | C18H30O5SSi |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyloxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](Sc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H30O5SSi/c1-18(2,3)25(4,5)22-11-13-14(19)15(20)16(21)17(23-13)24-12-9-7-6-8-10-12/h6-10,13-17,19-21H,11H2,1-5H3/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | TWBUWRKSGDZICZ-UHDSXZAQSA-N |
| XLogP | 2.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|