C12H21N9O6 — CID 11773609
3-[3,5-bis(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide (PubChem CID 11773609) has the molecular formula C12H21N9O6 and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-[3,5-bis(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide.
| Compound Name | 3-[3,5-bis(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 11773609 |
| Molecular Formula | C12H21N9O6 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-[3,5-bis(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide |
| SMILES | NNC(=O)CCn1c(=O)n(CCC(=O)NN)c(=O)n(CCC(=O)NN)c1=O |
| InChI | InChI=1S/C12H21N9O6/c13-16-7(22)1-4-19-10(25)20(5-2-8(23)17-14)12(27)21(11(19)26)6-3-9(24)18-15/h1-6,13-15H2,(H,16,22)(H,17,23)(H,18,24) |
| InChIKey | OHMMONILFHIRSU-UHFFFAOYSA-N |
| XLogP | -5.69 |
| TPSA | 231.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|