C28H38O — CID 11773714
(3R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[2-(4-methylphenyl)ethynyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 11773714) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[2-(4-methylphenyl)ethynyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[2-(4-methylphenyl)ethynyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11773714 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[2-(4-methylphenyl)ethynyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1ccc(C#C[C@H]2CC[C@H]3[C@@H]4CC[C@H]5C[C@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C28H38O/c1-19-4-6-20(7-5-19)8-9-21-11-13-25-24-12-10-22-18-23(29)14-16-28(22,3)26(24)15-17-27(21,25)2/h4-7,21-26,29H,10-18H2,1-3H3/t21-,22-,23+,24-,25-,26-,27+,28-/m0/s1 |
| InChIKey | LOQIZFKHJHYCEJ-GOMSDNTOSA-N |
| XLogP | 6.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|